C19H31IO5S — CID 11060130
1-[(4S)-4-[(2R)-4-iodo-1-methoxybutan-2-yl]oxy-6-methoxyhexyl]sulfonyl-4-methylbenzene (PubChem CID 11060130) has the molecular formula C19H31IO5S and a molecular weight of 498.42 g/mol. Its IUPAC name is 1-[(4S)-4-[(2R)-4-iodo-1-methoxybutan-2-yl]oxy-6-methoxyhexyl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[(4S)-4-[(2R)-4-iodo-1-methoxybutan-2-yl]oxy-6-methoxyhexyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 11060130 |
| Molecular Formula | C19H31IO5S |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 1-[(4S)-4-[(2R)-4-iodo-1-methoxybutan-2-yl]oxy-6-methoxyhexyl]sulfonyl-4-methylbenzene |
| SMILES | COCC[C@H](CCCS(=O)(=O)c1ccc(C)cc1)O[C@H](CCI)COC |
| InChI | InChI=1S/C19H31IO5S/c1-16-6-8-19(9-7-16)26(21,22)14-4-5-17(11-13-23-2)25-18(10-12-20)15-24-3/h6-9,17-18H,4-5,10-15H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | MHWUSHJTUONIOJ-ZWKOTPCHSA-N |
| XLogP | 3.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|