C31H38O3SSi — CID 134941140
(2Z,4Z)-7-[tert-butyl(diphenyl)silyl]oxy-4-[(R)-(4-methylphenyl)sulfinyl]octa-2,4-dien-1-ol (PubChem CID 134941140) has the molecular formula C31H38O3SSi and a molecular weight of 518.80 g/mol. Its IUPAC name is (2Z,4Z)-7-[tert-butyl(diphenyl)silyl]oxy-4-[(R)-(4-methylphenyl)sulfinyl]octa-2,4-dien-1-ol.
| Compound Name | (2Z,4Z)-7-[tert-butyl(diphenyl)silyl]oxy-4-[(R)-(4-methylphenyl)sulfinyl]octa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 134941140 |
| Molecular Formula | C31H38O3SSi |
| Molecular Weight | 518.80 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | (2Z,4Z)-7-[tert-butyl(diphenyl)silyl]oxy-4-[(R)-(4-methylphenyl)sulfinyl]octa-2,4-dien-1-ol |
| SMILES | Cc1ccc([S@](=O)C(/C=C\CO)=C\CC(C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H38O3SSi/c1-25-18-21-28(22-19-25)35(33)27(13-12-24-32)23-20-26(2)34-36(31(3,4)5,29-14-8-6-9-15-29)30-16-10-7-11-17-30/h6-19,21-23,26,32H,20,24H2,1-5H3/b13-12-,27-23-/t26?,35-/m1/s1 |
| InChIKey | WPTLPWKPOUBIPC-YQTBIESZSA-N |
| XLogP | 5.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.80 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|