C18H18O2S — CID 134882407
(2Z)-4-[(S)-(4-methylphenyl)sulfinyl]-3-phenylpenta-2,4-dien-1-ol (PubChem CID 134882407) has the molecular formula C18H18O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is (2Z)-4-[(S)-(4-methylphenyl)sulfinyl]-3-phenylpenta-2,4-dien-1-ol.
| Compound Name | (2Z)-4-[(S)-(4-methylphenyl)sulfinyl]-3-phenylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 134882407 |
| Molecular Formula | C18H18O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (2Z)-4-[(S)-(4-methylphenyl)sulfinyl]-3-phenylpenta-2,4-dien-1-ol |
| SMILES | C=C(/C(=C\CO)c1ccccc1)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H18O2S/c1-14-8-10-17(11-9-14)21(20)15(2)18(12-13-19)16-6-4-3-5-7-16/h3-12,19H,2,13H2,1H3/b18-12+/t21-/m1/s1 |
| InChIKey | LKZWDQQHZZBXQP-MUPHDSPYSA-N |
| XLogP | 3.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|