C36H38O2SSi — CID 134887408
(3S,4R,8E,10E)-11-[(R)-(4-methylphenyl)sulfinyl]-3-triphenylsilylundeca-1,8,10-trien-4-ol (PubChem CID 134887408) has the molecular formula C36H38O2SSi and a molecular weight of 562.85 g/mol. Its IUPAC name is (3S,4R,8E,10E)-11-[(R)-(4-methylphenyl)sulfinyl]-3-triphenylsilylundeca-1,8,10-trien-4-ol.
| Compound Name | (3S,4R,8E,10E)-11-[(R)-(4-methylphenyl)sulfinyl]-3-triphenylsilylundeca-1,8,10-trien-4-ol |
|---|---|
| PubChem CID | 134887408 |
| Molecular Formula | C36H38O2SSi |
| Molecular Weight | 562.85 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | (3S,4R,8E,10E)-11-[(R)-(4-methylphenyl)sulfinyl]-3-triphenylsilylundeca-1,8,10-trien-4-ol |
| SMILES | C=C[C@@H]([C@H](O)CCC/C=C/C=C/[S@@](=O)c1ccc(C)cc1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H38O2SSi/c1-3-36(35(37)24-16-5-4-6-17-29-39(38)31-27-25-30(2)26-28-31)40(32-18-10-7-11-19-32,33-20-12-8-13-21-33)34-22-14-9-15-23-34/h3-4,6-15,17-23,25-29,35-37H,1,5,16,24H2,2H3/b6-4+,29-17+/t35-,36+,39-/m1/s1 |
| InChIKey | YCDJNPPSQUNUPI-ISNJBPCOSA-N |
| XLogP | 6.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.85 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|