C30H33NO2SSi — CID 25038744
(1S)-2-[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]-1-phenylethanol (PubChem CID 25038744) has the molecular formula C30H33NO2SSi and a molecular weight of 499.75 g/mol. Its IUPAC name is (1S)-2-[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]-1-phenylethanol.
| Compound Name | (1S)-2-[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]-1-phenylethanol |
|---|---|
| PubChem CID | 25038744 |
| Molecular Formula | C30H33NO2SSi |
| Molecular Weight | 499.75 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | (1S)-2-[N-[tert-butyl(diphenyl)silyl]-S-phenylsulfonimidoyl]-1-phenylethanol |
| SMILES | CC(C)(C)[Si](N=[S@@](=O)(C[C@@H](O)c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33NO2SSi/c1-30(2,3)35(27-20-12-6-13-21-27,28-22-14-7-15-23-28)31-34(33,26-18-10-5-11-19-26)24-29(32)25-16-8-4-9-17-25/h4-23,29,32H,24H2,1-3H3/t29-,34-/m1/s1 |
| InChIKey | FNILOUQOAJGTJH-ANHUGMMASA-N |
| XLogP | 5.81 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.75 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|