C22H22O3S2 — CID 15174270
(1R)-2,2-bis[(S)-(4-methylphenyl)sulfinyl]-1-phenylethanol (PubChem CID 15174270) has the molecular formula C22H22O3S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is (1R)-2,2-bis[(S)-(4-methylphenyl)sulfinyl]-1-phenylethanol.
| Compound Name | (1R)-2,2-bis[(S)-(4-methylphenyl)sulfinyl]-1-phenylethanol |
|---|---|
| PubChem CID | 15174270 |
| Molecular Formula | C22H22O3S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (1R)-2,2-bis[(S)-(4-methylphenyl)sulfinyl]-1-phenylethanol |
| SMILES | Cc1ccc([S@](=O)C([C@H](O)c2ccccc2)[S@@](=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H22O3S2/c1-16-8-12-19(13-9-16)26(24)22(21(23)18-6-4-3-5-7-18)27(25)20-14-10-17(2)11-15-20/h3-15,21-23H,1-2H3/t21-,26+,27+/m1/s1 |
| InChIKey | JECIOANZFBQVIR-AIGMYPEUSA-N |
| XLogP | 4.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |