C36H41F3O4SSi — CID 163722301
3-(benzenesulfonyl)prop-1-en-2-ylbenzene;1-[dimethyl(phenyl)silyl]ethanol;1,1,1-trifluoro-4-phenylpent-4-en-2-ol (PubChem CID 163722301) has the molecular formula C36H41F3O4SSi and a molecular weight of 654.87 g/mol. Its IUPAC name is 3-(benzenesulfonyl)prop-1-en-2-ylbenzene;1-[dimethyl(phenyl)silyl]ethanol;1,1,1-trifluoro-4-phenylpent-4-en-2-ol.
| Compound Name | 3-(benzenesulfonyl)prop-1-en-2-ylbenzene;1-[dimethyl(phenyl)silyl]ethanol;1,1,1-trifluoro-4-phenylpent-4-en-2-ol |
|---|---|
| PubChem CID | 163722301 |
| Molecular Formula | C36H41F3O4SSi |
| Molecular Weight | 654.87 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | 3-(benzenesulfonyl)prop-1-en-2-ylbenzene;1-[dimethyl(phenyl)silyl]ethanol;1,1,1-trifluoro-4-phenylpent-4-en-2-ol |
| SMILES | C=C(CC(O)C(F)(F)F)c1ccccc1.C=C(CS(=O)(=O)c1ccccc1)c1ccccc1.CC(O)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H14O2S.C11H11F3O.C10H16OSi/c1-13(14-8-4-2-5-9-14)12-18(16,17)15-10-6-3-7-11-15;1-8(7-10(15)11(12,13)14)9-5-3-2-4-6-9;1-9(11)12(2,3)10-7-5-4-6-8-10/h2-11H,1,12H2;2-6,10,15H,1,7H2;4-9,11H,1-3H3 |
| InChIKey | KSPPHJBMPGFGHU-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.87 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|