C30H32O6S2 — CID 139180899
(1R,2S)-2-(benzenesulfonyl)-1-phenylpropan-1-ol (PubChem CID 139180899) has the molecular formula C30H32O6S2 and a molecular weight of 552.71 g/mol. Its IUPAC name is (1R,2S)-2-(benzenesulfonyl)-1-phenylpropan-1-ol.
| Compound Name | (1R,2S)-2-(benzenesulfonyl)-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 139180899 |
| Molecular Formula | C30H32O6S2 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | (1R,2S)-2-(benzenesulfonyl)-1-phenylpropan-1-ol |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)S(=O)(=O)c1ccccc1.C[C@@H]([C@H](O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/2C15H16O3S/c2*1-12(15(16)13-8-4-2-5-9-13)19(17,18)14-10-6-3-7-11-14/h2*2-12,15-16H,1H3/t2*12-,15-/m00/s1 |
| InChIKey | WZVOHIMPMFGVLY-AEGYSLAASA-N |
| XLogP | 5.16 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |