C33H36O2SSi — CID 23245908
(E,3S)-2-(4-methylphenyl)sulfinyl-1-triphenylsilyloct-1-en-3-ol (PubChem CID 23245908) has the molecular formula C33H36O2SSi and a molecular weight of 524.80 g/mol. Its IUPAC name is (E,3S)-2-(4-methylphenyl)sulfinyl-1-triphenylsilyloct-1-en-3-ol.
| Compound Name | (E,3S)-2-(4-methylphenyl)sulfinyl-1-triphenylsilyloct-1-en-3-ol |
|---|---|
| PubChem CID | 23245908 |
| Molecular Formula | C33H36O2SSi |
| Molecular Weight | 524.80 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | (E,3S)-2-(4-methylphenyl)sulfinyl-1-triphenylsilyloct-1-en-3-ol |
| SMILES | CCCCC[C@H](O)/C(=C\[Si](c1ccccc1)(c1ccccc1)c1ccccc1)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H36O2SSi/c1-3-4-8-21-32(34)33(36(35)28-24-22-27(2)23-25-28)26-37(29-15-9-5-10-16-29,30-17-11-6-12-18-30)31-19-13-7-14-20-31/h5-7,9-20,22-26,32,34H,3-4,8,21H2,1-2H3/b33-26+/t32-,36?/m0/s1 |
| InChIKey | MTMYWRIOQUPDCX-BXMUEYKZSA-N |
| XLogP | 5.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.80 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|