C40H52O6S2 — CID 139091735
(2S,3R,4R)-3-methyl-1-[(R)-(4-methylphenyl)sulfinyl]-6-phenylhexane-2,4-diol (PubChem CID 139091735) has the molecular formula C40H52O6S2 and a molecular weight of 692.98 g/mol. Its IUPAC name is (2S,3R,4R)-3-methyl-1-[(R)-(4-methylphenyl)sulfinyl]-6-phenylhexane-2,4-diol.
| Compound Name | (2S,3R,4R)-3-methyl-1-[(R)-(4-methylphenyl)sulfinyl]-6-phenylhexane-2,4-diol |
|---|---|
| PubChem CID | 139091735 |
| Molecular Formula | C40H52O6S2 |
| Molecular Weight | 692.98 g/mol |
| Exact Mass | 692.32 |
| IUPAC Name | (2S,3R,4R)-3-methyl-1-[(R)-(4-methylphenyl)sulfinyl]-6-phenylhexane-2,4-diol |
| SMILES | Cc1ccc([S@](=O)C[C@@H](O)[C@H](C)[C@H](O)CCc2ccccc2)cc1.Cc1ccc([S@](=O)C[C@@H](O)[C@H](C)[C@H](O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/2C20H26O3S/c2*1-15-8-11-18(12-9-15)24(23)14-20(22)16(2)19(21)13-10-17-6-4-3-5-7-17/h2*3-9,11-12,16,19-22H,10,13-14H2,1-2H3/t2*16-,19-,20-,24-/m11/s1 |
| InChIKey | DHSZPWSYSQNKIT-QJCWNCKXSA-N |
| XLogP | 6.19 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.98 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |