C16H26O2SSi — CID 11001416
(E,3S)-4-methyl-2-[(S)-(4-methylphenyl)sulfinyl]-1-trimethylsilylpent-1-en-3-ol (PubChem CID 11001416) has the molecular formula C16H26O2SSi and a molecular weight of 310.54 g/mol. Its IUPAC name is (E,3S)-4-methyl-2-[(S)-(4-methylphenyl)sulfinyl]-1-trimethylsilylpent-1-en-3-ol.
| Compound Name | (E,3S)-4-methyl-2-[(S)-(4-methylphenyl)sulfinyl]-1-trimethylsilylpent-1-en-3-ol |
|---|---|
| PubChem CID | 11001416 |
| Molecular Formula | C16H26O2SSi |
| Molecular Weight | 310.54 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (E,3S)-4-methyl-2-[(S)-(4-methylphenyl)sulfinyl]-1-trimethylsilylpent-1-en-3-ol |
| SMILES | Cc1ccc([S@](=O)/C(=C/[Si](C)(C)C)[C@@H](O)C(C)C)cc1 |
| InChI | InChI=1S/C16H26O2SSi/c1-12(2)16(17)15(11-20(4,5)6)19(18)14-9-7-13(3)8-10-14/h7-12,16-17H,1-6H3/b15-11+/t16-,19-/m0/s1 |
| InChIKey | NSBFHMOJNHURSS-KLTGIMADSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|