C23H22O4S — CID 13446882
(E)-2-(benzenesulfonyl)-1,5-diphenylpent-2-ene-1,5-diol (PubChem CID 13446882) has the molecular formula C23H22O4S and a molecular weight of 394.49 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-1,5-diphenylpent-2-ene-1,5-diol.
| Compound Name | (E)-2-(benzenesulfonyl)-1,5-diphenylpent-2-ene-1,5-diol |
|---|---|
| PubChem CID | 13446882 |
| Molecular Formula | C23H22O4S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-1,5-diphenylpent-2-ene-1,5-diol |
| SMILES | O=S(=O)(/C(=C/CC(O)c1ccccc1)C(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22O4S/c24-21(18-10-4-1-5-11-18)16-17-22(23(25)19-12-6-2-7-13-19)28(26,27)20-14-8-3-9-15-20/h1-15,17,21,23-25H,16H2/b22-17+ |
| InChIKey | RQDRRCNIDVSUNM-OQKWZONESA-N |
| XLogP | 4.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |