C19H34O3SSi — CID 10893996
(2S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]hexan-2-ol (PubChem CID 10893996) has the molecular formula C19H34O3SSi and a molecular weight of 370.63 g/mol. Its IUPAC name is (2S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]hexan-2-ol.
| Compound Name | (2S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]hexan-2-ol |
|---|---|
| PubChem CID | 10893996 |
| Molecular Formula | C19H34O3SSi |
| Molecular Weight | 370.63 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (2S)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(R)-(4-methylphenyl)sulfinyl]hexan-2-ol |
| SMILES | Cc1ccc([S@](=O)C[C@@H](O)CCCCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H34O3SSi/c1-16-10-12-18(13-11-16)23(21)15-17(20)9-7-8-14-22-24(5,6)19(2,3)4/h10-13,17,20H,7-9,14-15H2,1-6H3/t17-,23+/m0/s1 |
| InChIKey | LRIXUHFCRLZFAM-GAJHUEQPSA-N |
| XLogP | 4.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|