C20H34O3SSi — CID 11014449
2-methyl-6-methylidene-7-(4-methylphenyl)sulfonyl-8-trimethylsilyloctan-4-ol (PubChem CID 11014449) has the molecular formula C20H34O3SSi and a molecular weight of 382.64 g/mol. Its IUPAC name is 2-methyl-6-methylidene-7-(4-methylphenyl)sulfonyl-8-trimethylsilyloctan-4-ol.
| Compound Name | 2-methyl-6-methylidene-7-(4-methylphenyl)sulfonyl-8-trimethylsilyloctan-4-ol |
|---|---|
| PubChem CID | 11014449 |
| Molecular Formula | C20H34O3SSi |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-methyl-6-methylidene-7-(4-methylphenyl)sulfonyl-8-trimethylsilyloctan-4-ol |
| SMILES | C=C(CC(O)CC(C)C)C(C[Si](C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H34O3SSi/c1-15(2)12-18(21)13-17(4)20(14-25(5,6)7)24(22,23)19-10-8-16(3)9-11-19/h8-11,15,18,20-21H,4,12-14H2,1-3,5-7H3 |
| InChIKey | ZZZBGZAGWAROBQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|