C19H20O2S — CID 134882408
(2S,3Z)-5-[(S)-(4-methylphenyl)sulfinyl]-4-phenylhexa-3,5-dien-2-ol (PubChem CID 134882408) has the molecular formula C19H20O2S and a molecular weight of 312.43 g/mol. Its IUPAC name is (2S,3Z)-5-[(S)-(4-methylphenyl)sulfinyl]-4-phenylhexa-3,5-dien-2-ol.
| Compound Name | (2S,3Z)-5-[(S)-(4-methylphenyl)sulfinyl]-4-phenylhexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 134882408 |
| Molecular Formula | C19H20O2S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (2S,3Z)-5-[(S)-(4-methylphenyl)sulfinyl]-4-phenylhexa-3,5-dien-2-ol |
| SMILES | C=C(/C(=C\[C@H](C)O)c1ccccc1)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20O2S/c1-14-9-11-18(12-10-14)22(21)16(3)19(13-15(2)20)17-7-5-4-6-8-17/h4-13,15,20H,3H2,1-2H3/b19-13+/t15-,22+/m0/s1 |
| InChIKey | RGFCVNKIUDSKAR-STSOMYGVSA-N |
| XLogP | 4.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|