C28H32O2SSi — CID 134941139
tert-butyl-[5-[(S)-(4-methylphenyl)sulfinyl]pent-4-yn-2-yloxy]-diphenylsilane (PubChem CID 134941139) has the molecular formula C28H32O2SSi and a molecular weight of 460.72 g/mol. Its IUPAC name is tert-butyl-[5-[(S)-(4-methylphenyl)sulfinyl]pent-4-yn-2-yloxy]-diphenylsilane.
| Compound Name | tert-butyl-[5-[(S)-(4-methylphenyl)sulfinyl]pent-4-yn-2-yloxy]-diphenylsilane |
|---|---|
| PubChem CID | 134941139 |
| Molecular Formula | C28H32O2SSi |
| Molecular Weight | 460.72 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | tert-butyl-[5-[(S)-(4-methylphenyl)sulfinyl]pent-4-yn-2-yloxy]-diphenylsilane |
| SMILES | Cc1ccc([S@](=O)C#CCC(C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H32O2SSi/c1-23-18-20-25(21-19-23)31(29)22-12-13-24(2)30-32(28(3,4)5,26-14-8-6-9-15-26)27-16-10-7-11-17-27/h6-11,14-21,24H,13H2,1-5H3/t24?,31-/m1/s1 |
| InChIKey | IGWZGQIVHIFSTC-BMXGUMNWSA-N |
| XLogP | 5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.72 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|