C27H32O3SSi — CID 101406917
tert-butyl-[[2-methyl-3-(4-methylphenyl)sulfinyloxiran-2-yl]methoxy]-diphenylsilane (PubChem CID 101406917) has the molecular formula C27H32O3SSi and a molecular weight of 464.70 g/mol. Its IUPAC name is tert-butyl-[[2-methyl-3-(4-methylphenyl)sulfinyloxiran-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[2-methyl-3-(4-methylphenyl)sulfinyloxiran-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101406917 |
| Molecular Formula | C27H32O3SSi |
| Molecular Weight | 464.70 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | tert-butyl-[[2-methyl-3-(4-methylphenyl)sulfinyloxiran-2-yl]methoxy]-diphenylsilane |
| SMILES | Cc1ccc(S(=O)C2OC2(C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H32O3SSi/c1-21-16-18-22(19-17-21)31(28)25-27(5,30-25)20-29-32(26(2,3)4,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-19,25H,20H2,1-5H3 |
| InChIKey | ADNUUXGDKDVJES-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|