C24H36O3S2Si — CID 24881765
tert-butyl-dimethyl-[(2R)-2-methyl-3,3-bis[(S)-(4-methylphenyl)sulfinyl]propoxy]silane (PubChem CID 24881765) has the molecular formula C24H36O3S2Si and a molecular weight of 464.77 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R)-2-methyl-3,3-bis[(S)-(4-methylphenyl)sulfinyl]propoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2R)-2-methyl-3,3-bis[(S)-(4-methylphenyl)sulfinyl]propoxy]silane |
|---|---|
| PubChem CID | 24881765 |
| Molecular Formula | C24H36O3S2Si |
| Molecular Weight | 464.77 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | tert-butyl-dimethyl-[(2R)-2-methyl-3,3-bis[(S)-(4-methylphenyl)sulfinyl]propoxy]silane |
| SMILES | Cc1ccc([S@](=O)C([C@H](C)CO[Si](C)(C)C(C)(C)C)[S@@](=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H36O3S2Si/c1-18-9-13-21(14-10-18)28(25)23(29(26)22-15-11-19(2)12-16-22)20(3)17-27-30(7,8)24(4,5)6/h9-16,20,23H,17H2,1-8H3/t20-,28+,29+/m1/s1 |
| InChIKey | WKNMIRVNLRWNRM-YMUMJAELSA-N |
| XLogP | 6.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.77 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|