C28H32O4SSi — CID 14463511
5-[tert-butyl(diphenyl)silyl]oxypent-2-ynyl 4-methylbenzenesulfonate (PubChem CID 14463511) has the molecular formula C28H32O4SSi and a molecular weight of 492.71 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]oxypent-2-ynyl 4-methylbenzenesulfonate.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]oxypent-2-ynyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14463511 |
| Molecular Formula | C28H32O4SSi |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]oxypent-2-ynyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC#CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H32O4SSi/c1-24-18-20-25(21-19-24)33(29,30)31-22-12-7-13-23-32-34(28(2,3)4,26-14-8-5-9-15-26)27-16-10-6-11-17-27/h5-6,8-11,14-21H,13,22-23H2,1-4H3 |
| InChIKey | ACDGSHFJMIZIGL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|