C29H34O5SSi — CID 102238802
methyl (3S)-2-(benzenesulfonyl)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-4-enoate (PubChem CID 102238802) has the molecular formula C29H34O5SSi and a molecular weight of 522.74 g/mol. Its IUPAC name is methyl (3S)-2-(benzenesulfonyl)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-4-enoate.
| Compound Name | methyl (3S)-2-(benzenesulfonyl)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-4-enoate |
|---|---|
| PubChem CID | 102238802 |
| Molecular Formula | C29H34O5SSi |
| Molecular Weight | 522.74 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | methyl (3S)-2-(benzenesulfonyl)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pent-4-enoate |
| SMILES | C=C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H34O5SSi/c1-6-23(27(28(30)33-5)35(31,32)24-16-10-7-11-17-24)22-34-36(29(2,3)4,25-18-12-8-13-19-25)26-20-14-9-15-21-26/h6-21,23,27H,1,22H2,2-5H3/t23-,27?/m0/s1 |
| InChIKey | FCWQZTSISPOMMK-DCCUJTHKSA-N |
| XLogP | 4.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.74 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|