C33H36O2S2Si — CID 56628482
[(2S)-4,4-bis(phenylsulfanyl)oxolan-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 56628482) has the molecular formula C33H36O2S2Si and a molecular weight of 556.87 g/mol. Its IUPAC name is [(2S)-4,4-bis(phenylsulfanyl)oxolan-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(2S)-4,4-bis(phenylsulfanyl)oxolan-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 56628482 |
| Molecular Formula | C33H36O2S2Si |
| Molecular Weight | 556.87 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | [(2S)-4,4-bis(phenylsulfanyl)oxolan-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC(Sc2ccccc2)(Sc2ccccc2)CO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H36O2S2Si/c1-32(2,3)38(30-20-12-6-13-21-30,31-22-14-7-15-23-31)35-25-27-24-33(26-34-27,36-28-16-8-4-9-17-28)37-29-18-10-5-11-19-29/h4-23,27H,24-26H2,1-3H3/t27-/m0/s1 |
| InChIKey | UJEIKDUESCGTHN-MHZLTWQESA-N |
| XLogP | 7.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.87 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|