C27H32O2SSi — CID 139640160
tert-butyl-diphenyl-[[(2S)-5-phenylsulfanyloxolan-2-yl]methoxy]silane (PubChem CID 139640160) has the molecular formula C27H32O2SSi and a molecular weight of 448.70 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(2S)-5-phenylsulfanyloxolan-2-yl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(2S)-5-phenylsulfanyloxolan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 139640160 |
| Molecular Formula | C27H32O2SSi |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | tert-butyl-diphenyl-[[(2S)-5-phenylsulfanyloxolan-2-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CCC(Sc2ccccc2)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32O2SSi/c1-27(2,3)31(24-15-9-5-10-16-24,25-17-11-6-12-18-25)28-21-22-19-20-26(29-22)30-23-13-7-4-8-14-23/h4-18,22,26H,19-21H2,1-3H3/t22-,26?/m0/s1 |
| InChIKey | ZRQKLYLXUOVMSV-CHQVSRGASA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|