C31H38O4SSi — CID 135041956
[(3aR,6R,7aR)-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 135041956) has the molecular formula C31H38O4SSi and a molecular weight of 534.79 g/mol. Its IUPAC name is [(3aR,6R,7aR)-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,6R,7aR)-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 135041956 |
| Molecular Formula | C31H38O4SSi |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | [(3aR,6R,7aR)-2,2-dimethyl-6-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC1(C)O[C@@H]2C[C@@H](Sc3ccccc3)OC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]2O1 |
| InChI | InChI=1S/C31H38O4SSi/c1-30(2,3)37(24-17-11-7-12-18-24,25-19-13-8-14-20-25)32-22-27-29-26(34-31(4,5)35-29)21-28(33-27)36-23-15-9-6-10-16-23/h6-20,26-29H,21-22H2,1-5H3/t26-,27?,28-,29-/m1/s1 |
| InChIKey | CMLPQWOSZSCZGS-VCUUIAPISA-N |
| XLogP | 5.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|