C20H32O4SSi — CID 135078545
[(3aR,7S,7aS)-2,2-dimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 135078545) has the molecular formula C20H32O4SSi and a molecular weight of 396.63 g/mol. Its IUPAC name is [(3aR,7S,7aS)-2,2-dimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,7S,7aS)-2,2-dimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135078545 |
| Molecular Formula | C20H32O4SSi |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [(3aR,7S,7aS)-2,2-dimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)COC(Sc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C20H32O4SSi/c1-19(2,3)26(6,7)24-15-13-21-18(25-14-11-9-8-10-12-14)17-16(15)22-20(4,5)23-17/h8-12,15-18H,13H2,1-7H3/t15-,16+,17+,18?/m0/s1 |
| InChIKey | NENPHHVYYJIYTI-LNAREIQUSA-N |
| XLogP | 5.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|