C14H16O4S2 — CID 11347488
(3aR,4S,6S,7S,7aR)-7-methoxy-6-methyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-thione (PubChem CID 11347488) has the molecular formula C14H16O4S2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (3aR,4S,6S,7S,7aR)-7-methoxy-6-methyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-thione.
| Compound Name | (3aR,4S,6S,7S,7aR)-7-methoxy-6-methyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-thione |
|---|---|
| PubChem CID | 11347488 |
| Molecular Formula | C14H16O4S2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | (3aR,4S,6S,7S,7aR)-7-methoxy-6-methyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-thione |
| SMILES | CO[C@@H]1[C@H]2OC(=S)O[C@H]2[C@H](Sc2ccccc2)O[C@H]1C |
| InChI | InChI=1S/C14H16O4S2/c1-8-10(15-2)11-12(18-14(19)17-11)13(16-8)20-9-6-4-3-5-7-9/h3-8,10-13H,1-2H3/t8-,10-,11+,12+,13-/m0/s1 |
| InChIKey | MNAFQFKUOUUBBE-FXAPSIEYSA-N |
| XLogP | 2.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|