C27H38F4O4S — CID 171558811
2,2-dimethyl-4-(phenylsulfanylmethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;ethane;[(2E,4Z,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-2-yl] hypofluorite (PubChem CID 171558811) has the molecular formula C27H38F4O4S and a molecular weight of 534.66 g/mol. Its IUPAC name is 2,2-dimethyl-4-(phenylsulfanylmethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;ethane;[(2E,4Z,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-2-yl] hypofluorite.
| Compound Name | 2,2-dimethyl-4-(phenylsulfanylmethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;ethane;[(2E,4Z,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-2-yl] hypofluorite |
|---|---|
| PubChem CID | 171558811 |
| Molecular Formula | C27H38F4O4S |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | 2,2-dimethyl-4-(phenylsulfanylmethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;ethane;[(2E,4Z,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-2-yl] hypofluorite |
| SMILES | CC.CC/C=C(/C=C\C=C(/C)OF)C(F)(F)F.CC1(C)OC2CCOC(CSc3ccccc3)C2O1 |
| InChI | InChI=1S/C15H20O3S.C10H12F4O.C2H6/c1-15(2)17-12-8-9-16-13(14(12)18-15)10-19-11-6-4-3-5-7-11;1-3-5-9(10(11,12)13)7-4-6-8(2)15-14;1-2/h3-7,12-14H,8-10H2,1-2H3;4-7H,3H2,1-2H3;1-2H3/b;7-4-,8-6+,9-5-; |
| InChIKey | SDVTZGLXYWGZDI-FHHDXQPHSA-N |
| XLogP | 8.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|