C14H18O3S — CID 135071529
(4aR,6R,7aS)-2,2-dimethyl-6-phenylsulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine (PubChem CID 135071529) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is (4aR,6R,7aS)-2,2-dimethyl-6-phenylsulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6R,7aS)-2,2-dimethyl-6-phenylsulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 135071529 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (4aR,6R,7aS)-2,2-dimethyl-6-phenylsulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine |
| SMILES | CC1(C)OC[C@H]2O[C@H](Sc3ccccc3)C[C@@H]2O1 |
| InChI | InChI=1S/C14H18O3S/c1-14(2)15-9-12-11(17-14)8-13(16-12)18-10-6-4-3-5-7-10/h3-7,11-13H,8-9H2,1-2H3/t11-,12+,13+/m0/s1 |
| InChIKey | IOLOCYFXPKFSEW-YNEHKIRRSA-N |
| XLogP | 3.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |