C18H24O5S — CID 14332316
(1S,2S,6R,7S,9R)-4,4,12,12-tetramethyl-7-phenylsulfanyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane (PubChem CID 14332316) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is (1S,2S,6R,7S,9R)-4,4,12,12-tetramethyl-7-phenylsulfanyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1S,2S,6R,7S,9R)-4,4,12,12-tetramethyl-7-phenylsulfanyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 14332316 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (1S,2S,6R,7S,9R)-4,4,12,12-tetramethyl-7-phenylsulfanyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecane |
| SMILES | CC1(C)OC[C@H]2O[C@@H](Sc3ccccc3)[C@@H]3OC(C)(C)O[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C18H24O5S/c1-17(2)19-10-12-13(21-17)14-15(23-18(3,4)22-14)16(20-12)24-11-8-6-5-7-9-11/h5-9,12-16H,10H2,1-4H3/t12-,13+,14+,15-,16+/m1/s1 |
| InChIKey | OCJVIUSJTHFQCU-CWVYHPPDSA-N |
| XLogP | 3.18 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |