C15H16O5S2 — CID 134844699
[(4R,7R)-6-methyl-4-phenylsulfanyl-2-sulfanylidene-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate (PubChem CID 134844699) has the molecular formula C15H16O5S2 and a molecular weight of 340.42 g/mol. Its IUPAC name is [(4R,7R)-6-methyl-4-phenylsulfanyl-2-sulfanylidene-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate.
| Compound Name | [(4R,7R)-6-methyl-4-phenylsulfanyl-2-sulfanylidene-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 134844699 |
| Molecular Formula | C15H16O5S2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | [(4R,7R)-6-methyl-4-phenylsulfanyl-2-sulfanylidene-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(C)O[C@H](Sc2ccccc2)C2OC(=S)OC21 |
| InChI | InChI=1S/C15H16O5S2/c1-8-11(18-9(2)16)12-13(20-15(21)19-12)14(17-8)22-10-6-4-3-5-7-10/h3-8,11-14H,1-2H3/t8?,11-,12?,13?,14-/m1/s1 |
| InChIKey | IQJDCDDDPDHTQV-CWIGPELTSA-N |
| XLogP | 2.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|