C18H24O5S — CID 603717
6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-4-phenylsulfanyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole (PubChem CID 603717) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-4-phenylsulfanyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole.
| Compound Name | 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-4-phenylsulfanyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 603717 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-4-phenylsulfanyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole |
| SMILES | CC1(C)OCC(C2OC(Sc3ccccc3)C3OC(C)(C)OC23)O1 |
| InChI | InChI=1S/C18H24O5S/c1-17(2)19-10-12(21-17)13-14-15(23-18(3,4)22-14)16(20-13)24-11-8-6-5-7-9-11/h5-9,12-16H,10H2,1-4H3 |
| InChIKey | YLWWDUNGLIZGHD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |