C20H26O8S — CID 11189510
(1R,2S,6S,8S)-6-[[(E)-2-(benzenesulfonyl)ethenoxy]methyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane (PubChem CID 11189510) has the molecular formula C20H26O8S and a molecular weight of 426.49 g/mol. Its IUPAC name is (1R,2S,6S,8S)-6-[[(E)-2-(benzenesulfonyl)ethenoxy]methyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane.
| Compound Name | (1R,2S,6S,8S)-6-[[(E)-2-(benzenesulfonyl)ethenoxy]methyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 11189510 |
| Molecular Formula | C20H26O8S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | (1R,2S,6S,8S)-6-[[(E)-2-(benzenesulfonyl)ethenoxy]methyl]-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane |
| SMILES | CC1(C)OC[C@@H]2O[C@@]3(CO/C=C/S(=O)(=O)c4ccccc4)OC(C)(C)O[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C20H26O8S/c1-18(2)24-12-15-16(26-18)17-20(25-15,28-19(3,4)27-17)13-23-10-11-29(21,22)14-8-6-5-7-9-14/h5-11,15-17H,12-13H2,1-4H3/b11-10+/t15-,16+,17-,20-/m0/s1 |
| InChIKey | SAEGPYAZMBJULD-RWQXAHCASA-N |
| XLogP | 2.35 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|