C20H26O8S — CID 14914460
(E,1S)-3-(benzenesulfonyl)-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-en-1-ol (PubChem CID 14914460) has the molecular formula C20H26O8S and a molecular weight of 426.49 g/mol. Its IUPAC name is (E,1S)-3-(benzenesulfonyl)-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-en-1-ol.
| Compound Name | (E,1S)-3-(benzenesulfonyl)-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 14914460 |
| Molecular Formula | C20H26O8S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | (E,1S)-3-(benzenesulfonyl)-1-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]prop-2-en-1-ol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1OC(C)(C)O[C@H]1O[C@@H]2[C@@H](O)/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H26O8S/c1-19(2)25-15-14(24-18-17(16(15)26-19)27-20(3,4)28-18)13(21)10-11-29(22,23)12-8-6-5-7-9-12/h5-11,13-18,21H,1-4H3/b11-10+/t13-,14+,15-,16-,17+,18+/m0/s1 |
| InChIKey | MIISZTMRNYDSEM-AOLBXENASA-N |
| XLogP | 1.73 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |