C20H30O6S — CID 134879138
(1R,2S,3R)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-(methoxymethoxy)-4-phenylsulfanylbutane-1,3-diol (PubChem CID 134879138) has the molecular formula C20H30O6S and a molecular weight of 398.52 g/mol. Its IUPAC name is (1R,2S,3R)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-(methoxymethoxy)-4-phenylsulfanylbutane-1,3-diol.
| Compound Name | (1R,2S,3R)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-(methoxymethoxy)-4-phenylsulfanylbutane-1,3-diol |
|---|---|
| PubChem CID | 134879138 |
| Molecular Formula | C20H30O6S |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (1R,2S,3R)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-2-(methoxymethoxy)-4-phenylsulfanylbutane-1,3-diol |
| SMILES | COCO[C@@H]([C@H](O)[C@H]1COC2(CCCCC2)O1)[C@@H](O)CSc1ccccc1 |
| InChI | InChI=1S/C20H30O6S/c1-23-14-24-19(16(21)13-27-15-8-4-2-5-9-15)18(22)17-12-25-20(26-17)10-6-3-7-11-20/h2,4-5,8-9,16-19,21-22H,3,6-7,10-14H2,1H3/t16-,17+,18+,19+/m0/s1 |
| InChIKey | PHRCVLPCMXUDPQ-WJFTUGDTSA-N |
| XLogP | 2.57 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|