C23H35FO5SSi — CID 138966336
(3S,6R)-2-[[4-[ditert-butyl(fluoro)silyl]phenyl]sulfanylmethyl]-6-prop-2-ynoxyoxane-3,4,5-triol (PubChem CID 138966336) has the molecular formula C23H35FO5SSi and a molecular weight of 470.68 g/mol. Its IUPAC name is (3S,6R)-2-[[4-[ditert-butyl(fluoro)silyl]phenyl]sulfanylmethyl]-6-prop-2-ynoxyoxane-3,4,5-triol.
| Compound Name | (3S,6R)-2-[[4-[ditert-butyl(fluoro)silyl]phenyl]sulfanylmethyl]-6-prop-2-ynoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 138966336 |
| Molecular Formula | C23H35FO5SSi |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | (3S,6R)-2-[[4-[ditert-butyl(fluoro)silyl]phenyl]sulfanylmethyl]-6-prop-2-ynoxyoxane-3,4,5-triol |
| SMILES | C#CCO[C@@H]1OC(CSc2ccc([Si](F)(C(C)(C)C)C(C)(C)C)cc2)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C23H35FO5SSi/c1-8-13-28-21-20(27)19(26)18(25)17(29-21)14-30-15-9-11-16(12-10-15)31(24,22(2,3)4)23(5,6)7/h1,9-12,17-21,25-27H,13-14H2,2-7H3/t17?,18-,19?,20?,21-/m1/s1 |
| InChIKey | KEBUJYTXCNGTCP-UCYAAXKESA-N |
| XLogP | 2.96 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|