C28H36O15S — CID 45100520
[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-3-[(2S,3R,4S,5S,6R)-3,4-diacetyloxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-phenylsulfanyloxan-2-yl]methyl acetate (PubChem CID 45100520) has the molecular formula C28H36O15S and a molecular weight of 644.65 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-3-[(2S,3R,4S,5S,6R)-3,4-diacetyloxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-phenylsulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-3-[(2S,3R,4S,5S,6R)-3,4-diacetyloxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-phenylsulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 45100520 |
| Molecular Formula | C28H36O15S |
| Molecular Weight | 644.65 g/mol |
| Exact Mass | 644.18 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-3-[(2S,3R,4S,5S,6R)-3,4-diacetyloxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-phenylsulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Sc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H36O15S/c1-13(30)36-12-20-22(43-27-25(39-16(4)33)23(37-14(2)31)21(35)19(11-29)41-27)24(38-15(3)32)26(40-17(5)34)28(42-20)44-18-9-7-6-8-10-18/h6-10,19-29,35H,11-12H2,1-5H3/t19-,20-,21+,22-,23+,24+,25-,26-,27+,28+/m1/s1 |
| InChIKey | POLNXKJIRPICBL-JRFIZLOQSA-N |
| XLogP | 0.26 |
| TPSA | 199.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.65 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|