C18H26O8S — CID 146169946
(2S,5R)-2-[(2S,5R)-4,5-dihydroxy-6-methyl-2-phenylsulfanyloxan-3-yl]oxy-6-methyloxane-3,4,5-triol (PubChem CID 146169946) has the molecular formula C18H26O8S and a molecular weight of 402.47 g/mol. Its IUPAC name is (2S,5R)-2-[(2S,5R)-4,5-dihydroxy-6-methyl-2-phenylsulfanyloxan-3-yl]oxy-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,5R)-2-[(2S,5R)-4,5-dihydroxy-6-methyl-2-phenylsulfanyloxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 146169946 |
| Molecular Formula | C18H26O8S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (2S,5R)-2-[(2S,5R)-4,5-dihydroxy-6-methyl-2-phenylsulfanyloxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
| SMILES | CC1O[C@@H](OC2C(O)[C@@H](O)C(C)O[C@H]2Sc2ccccc2)C(O)C(O)[C@H]1O |
| InChI | InChI=1S/C18H26O8S/c1-8-11(19)13(21)15(23)17(24-8)26-16-14(22)12(20)9(2)25-18(16)27-10-6-4-3-5-7-10/h3-9,11-23H,1-2H3/t8?,9?,11-,12-,13?,14?,15?,16?,17-,18-/m0/s1 |
| InChIKey | CDEAVQUGAUYTNQ-MMOXVAJJSA-N |
| XLogP | -0.54 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |