C15H20O4S — CID 164670880
(4R,7S)-2,2,6-trimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 164670880) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is (4R,7S)-2,2,6-trimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (4R,7S)-2,2,6-trimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 164670880 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (4R,7S)-2,2,6-trimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CC1O[C@H](Sc2ccccc2)C2OC(C)(C)OC2[C@H]1O |
| InChI | InChI=1S/C15H20O4S/c1-9-11(16)12-13(19-15(2,3)18-12)14(17-9)20-10-7-5-4-6-8-10/h4-9,11-14,16H,1-3H3/t9?,11-,12?,13?,14+/m0/s1 |
| InChIKey | YOEZBAWYJHTIPW-NEWQRBNTSA-N |
| XLogP | 2.40 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |