C14H16O3S — CID 11644661
(6S,8R)-6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-ol (PubChem CID 11644661) has the molecular formula C14H16O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is (6S,8R)-6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-ol.
| Compound Name | (6S,8R)-6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-ol |
|---|---|
| PubChem CID | 11644661 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (6S,8R)-6-phenylsulfanyl-1,4-dioxaspiro[4.5]dec-9-en-8-ol |
| SMILES | O[C@H]1C=CC2(OCCO2)[C@@H](Sc2ccccc2)C1 |
| InChI | InChI=1S/C14H16O3S/c15-11-6-7-14(16-8-9-17-14)13(10-11)18-12-4-2-1-3-5-12/h1-7,11,13,15H,8-10H2/t11-,13-/m0/s1 |
| InChIKey | OYMWLUCPPNPIOI-AAEUAGOBSA-N |
| XLogP | 2.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|