C25H33F3O4S — CID 171556645
2,2-dimethyl-4-(phenylsulfanylmethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;(2E,4Z,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-2-ol (PubChem CID 171556645) has the molecular formula C25H33F3O4S and a molecular weight of 486.60 g/mol. Its IUPAC name is 2,2-dimethyl-4-(phenylsulfanylmethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;(2E,4Z,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-2-ol.
| Compound Name | 2,2-dimethyl-4-(phenylsulfanylmethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;(2E,4Z,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-2-ol |
|---|---|
| PubChem CID | 171556645 |
| Molecular Formula | C25H33F3O4S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2,2-dimethyl-4-(phenylsulfanylmethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran;(2E,4Z,6Z)-6-(trifluoromethyl)nona-2,4,6-trien-2-ol |
| SMILES | CC/C=C(/C=C\C=C(/C)O)C(F)(F)F.CC1(C)OC2CCOC(CSc3ccccc3)C2O1 |
| InChI | InChI=1S/C15H20O3S.C10H13F3O/c1-15(2)17-12-8-9-16-13(14(12)18-15)10-19-11-6-4-3-5-7-11;1-3-5-9(10(11,12)13)7-4-6-8(2)14/h3-7,12-14H,8-10H2,1-2H3;4-7,14H,3H2,1-2H3/b;7-4-,8-6+,9-5- |
| InChIKey | HNVRJCQEDFDYND-MMLZKQSISA-N |
| XLogP | 6.99 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|