C17H22O5S — CID 164671253
[(4S,7S)-2,2,6-trimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate (PubChem CID 164671253) has the molecular formula C17H22O5S and a molecular weight of 338.43 g/mol. Its IUPAC name is [(4S,7S)-2,2,6-trimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate.
| Compound Name | [(4S,7S)-2,2,6-trimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 164671253 |
| Molecular Formula | C17H22O5S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [(4S,7S)-2,2,6-trimethyl-4-phenylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(C)O[C@@H](Sc2ccccc2)C2OC(C)(C)OC21 |
| InChI | InChI=1S/C17H22O5S/c1-10-13(20-11(2)18)14-15(22-17(3,4)21-14)16(19-10)23-12-8-6-5-7-9-12/h5-10,13-16H,1-4H3/t10?,13-,14?,15?,16-/m0/s1 |
| InChIKey | YXXOPDXQLPQFCF-FVRJHXOCSA-N |
| XLogP | 2.98 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |