C36H47FO4SSi — CID 102075530
tert-butyl-[(2R)-2-[(4S,5S)-2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl]-2-(3-fluorohept-1-en-2-yloxy)ethoxy]-diphenylsilane (PubChem CID 102075530) has the molecular formula C36H47FO4SSi and a molecular weight of 622.92 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-[(4S,5S)-2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl]-2-(3-fluorohept-1-en-2-yloxy)ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R)-2-[(4S,5S)-2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl]-2-(3-fluorohept-1-en-2-yloxy)ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 102075530 |
| Molecular Formula | C36H47FO4SSi |
| Molecular Weight | 622.92 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | tert-butyl-[(2R)-2-[(4S,5S)-2,2-dimethyl-5-phenylsulfanyl-1,3-dioxolan-4-yl]-2-(3-fluorohept-1-en-2-yloxy)ethoxy]-diphenylsilane |
| SMILES | C=C(O[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1Sc1ccccc1)C(F)CCCC |
| InChI | InChI=1S/C36H47FO4SSi/c1-8-9-25-31(37)27(2)39-32(33-34(41-36(6,7)40-33)42-28-19-13-10-14-20-28)26-38-43(35(3,4)5,29-21-15-11-16-22-29)30-23-17-12-18-24-30/h10-24,31-34H,2,8-9,25-26H2,1,3-7H3/t31?,32-,33+,34+/m1/s1 |
| InChIKey | WCBSHFSHSDMKBA-OYKWTTPJSA-N |
| XLogP | 8.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.92 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|