C30H40O3SSi — CID 10255720
tert-butyl-[(2S,3S)-2-(methoxymethoxy)-3-methyl-5-phenylsulfanylpentoxy]-diphenylsilane (PubChem CID 10255720) has the molecular formula C30H40O3SSi and a molecular weight of 508.80 g/mol. Its IUPAC name is tert-butyl-[(2S,3S)-2-(methoxymethoxy)-3-methyl-5-phenylsulfanylpentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S,3S)-2-(methoxymethoxy)-3-methyl-5-phenylsulfanylpentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10255720 |
| Molecular Formula | C30H40O3SSi |
| Molecular Weight | 508.80 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | tert-butyl-[(2S,3S)-2-(methoxymethoxy)-3-methyl-5-phenylsulfanylpentoxy]-diphenylsilane |
| SMILES | COCO[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)CCSc1ccccc1 |
| InChI | InChI=1S/C30H40O3SSi/c1-25(21-22-34-26-15-9-6-10-16-26)29(32-24-31-5)23-33-35(30(2,3)4,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-20,25,29H,21-24H2,1-5H3/t25-,29+/m0/s1 |
| InChIKey | MTJWREUREZQOEK-ABYGYWHVSA-N |
| XLogP | 6.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.80 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|