C31H42O3SSi — CID 10554039
tert-butyl-[(2R)-2-(methoxymethoxy)-7-phenylsulfanylheptoxy]-diphenylsilane (PubChem CID 10554039) has the molecular formula C31H42O3SSi and a molecular weight of 522.83 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-(methoxymethoxy)-7-phenylsulfanylheptoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R)-2-(methoxymethoxy)-7-phenylsulfanylheptoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10554039 |
| Molecular Formula | C31H42O3SSi |
| Molecular Weight | 522.83 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | tert-butyl-[(2R)-2-(methoxymethoxy)-7-phenylsulfanylheptoxy]-diphenylsilane |
| SMILES | COCO[C@H](CCCCCSc1ccccc1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H42O3SSi/c1-31(2,3)36(29-20-12-6-13-21-29,30-22-14-7-15-23-30)34-25-27(33-26-32-4)17-9-8-16-24-35-28-18-10-5-11-19-28/h5-7,10-15,18-23,27H,8-9,16-17,24-26H2,1-4H3/t27-/m1/s1 |
| InChIKey | BUUNATYLYJVKEC-HHHXNRCGSA-N |
| XLogP | 6.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.83 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|