C21H36O2S3Si — CID 10366201
(3R)-4-[(2S)-2-phenylsulfanylthian-2-yl]-3-(2-trimethylsilylethoxymethoxy)butane-1-thiol (PubChem CID 10366201) has the molecular formula C21H36O2S3Si and a molecular weight of 444.80 g/mol. Its IUPAC name is (3R)-4-[(2S)-2-phenylsulfanylthian-2-yl]-3-(2-trimethylsilylethoxymethoxy)butane-1-thiol.
| Compound Name | (3R)-4-[(2S)-2-phenylsulfanylthian-2-yl]-3-(2-trimethylsilylethoxymethoxy)butane-1-thiol |
|---|---|
| PubChem CID | 10366201 |
| Molecular Formula | C21H36O2S3Si |
| Molecular Weight | 444.80 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (3R)-4-[(2S)-2-phenylsulfanylthian-2-yl]-3-(2-trimethylsilylethoxymethoxy)butane-1-thiol |
| SMILES | C[Si](C)(C)CCOCO[C@H](CCS)C[C@@]1(Sc2ccccc2)CCCCS1 |
| InChI | InChI=1S/C21H36O2S3Si/c1-27(2,3)16-13-22-18-23-19(11-14-24)17-21(12-7-8-15-25-21)26-20-9-5-4-6-10-20/h4-6,9-10,19,24H,7-8,11-18H2,1-3H3/t19-,21+/m1/s1 |
| InChIKey | ZEFUZSJJJGSFLG-CTNGQTDRSA-N |
| XLogP | 6.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.80 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|