C19H30O2S — CID 14172398
5-(methoxymethoxy)undec-1-en-2-ylsulfanylbenzene (PubChem CID 14172398) has the molecular formula C19H30O2S and a molecular weight of 322.51 g/mol. Its IUPAC name is 5-(methoxymethoxy)undec-1-en-2-ylsulfanylbenzene.
| Compound Name | 5-(methoxymethoxy)undec-1-en-2-ylsulfanylbenzene |
|---|---|
| PubChem CID | 14172398 |
| Molecular Formula | C19H30O2S |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 5-(methoxymethoxy)undec-1-en-2-ylsulfanylbenzene |
| SMILES | C=C(CCC(CCCCCC)OCOC)Sc1ccccc1 |
| InChI | InChI=1S/C19H30O2S/c1-4-5-6-8-11-18(21-16-20-3)15-14-17(2)22-19-12-9-7-10-13-19/h7,9-10,12-13,18H,2,4-6,8,11,14-16H2,1,3H3 |
| InChIKey | CWNHCJUIQWKFAY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|