C15H20O2S — CID 86034417
[6-(ethoxymethoxy)cyclohexen-1-yl]sulfanylbenzene (PubChem CID 86034417) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is [6-(ethoxymethoxy)cyclohexen-1-yl]sulfanylbenzene.
| Compound Name | [6-(ethoxymethoxy)cyclohexen-1-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 86034417 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | [6-(ethoxymethoxy)cyclohexen-1-yl]sulfanylbenzene |
| SMILES | CCOCOC1CCCC=C1Sc1ccccc1 |
| InChI | InChI=1S/C15H20O2S/c1-2-16-12-17-14-10-6-7-11-15(14)18-13-8-4-3-5-9-13/h3-5,8-9,11,14H,2,6-7,10,12H2,1H3 |
| InChIKey | KIOSQXFIZJPKOP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|