C14H18O2S — CID 86034408
[5-(ethoxymethoxy)cyclopenten-1-yl]sulfanylbenzene (PubChem CID 86034408) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is [5-(ethoxymethoxy)cyclopenten-1-yl]sulfanylbenzene.
| Compound Name | [5-(ethoxymethoxy)cyclopenten-1-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 86034408 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | [5-(ethoxymethoxy)cyclopenten-1-yl]sulfanylbenzene |
| SMILES | CCOCOC1CCC=C1Sc1ccccc1 |
| InChI | InChI=1S/C14H18O2S/c1-2-15-11-16-13-9-6-10-14(13)17-12-7-4-3-5-8-12/h3-5,7-8,10,13H,2,6,9,11H2,1H3 |
| InChIKey | YFVCUHQPFWTRJZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|