C15H22O3S — CID 10924025
[(Z)-2,3,3-triethoxyprop-1-enyl]sulfanylbenzene (PubChem CID 10924025) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is [(Z)-2,3,3-triethoxyprop-1-enyl]sulfanylbenzene.
| Compound Name | [(Z)-2,3,3-triethoxyprop-1-enyl]sulfanylbenzene |
|---|---|
| PubChem CID | 10924025 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | [(Z)-2,3,3-triethoxyprop-1-enyl]sulfanylbenzene |
| SMILES | CCO/C(=C\Sc1ccccc1)C(OCC)OCC |
| InChI | InChI=1S/C15H22O3S/c1-4-16-14(15(17-5-2)18-6-3)12-19-13-10-8-7-9-11-13/h7-12,15H,4-6H2,1-3H3/b14-12- |
| InChIKey | QEGBUFUXVJINES-OWBHPGMISA-N |
| XLogP | 4.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|