C12H16O2S — CID 14890214
[(E)-4,4-dimethoxybut-2-enyl]sulfanylbenzene (PubChem CID 14890214) has the molecular formula C12H16O2S and a molecular weight of 224.32 g/mol. Its IUPAC name is [(E)-4,4-dimethoxybut-2-enyl]sulfanylbenzene.
| Compound Name | [(E)-4,4-dimethoxybut-2-enyl]sulfanylbenzene |
|---|---|
| PubChem CID | 14890214 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | [(E)-4,4-dimethoxybut-2-enyl]sulfanylbenzene |
| SMILES | COC(/C=C/CSc1ccccc1)OC |
| InChI | InChI=1S/C12H16O2S/c1-13-12(14-2)9-6-10-15-11-7-4-3-5-8-11/h3-9,12H,10H2,1-2H3/b9-6+ |
| InChIKey | VEWDLPONOOYTKO-RMKNXTFCSA-N |
| XLogP | 2.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|