C14H20O2S — CID 10634598
1-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanyl-2-methylbenzene (PubChem CID 10634598) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanyl-2-methylbenzene.
| Compound Name | 1-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanyl-2-methylbenzene |
|---|---|
| PubChem CID | 10634598 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1-[(E)-4,4-dimethoxy-2-methylbut-2-enyl]sulfanyl-2-methylbenzene |
| SMILES | COC(/C=C(\C)CSc1ccccc1C)OC |
| InChI | InChI=1S/C14H20O2S/c1-11(9-14(15-3)16-4)10-17-13-8-6-5-7-12(13)2/h5-9,14H,10H2,1-4H3/b11-9+ |
| InChIKey | DACFLYNUNOLXFX-PKNBQFBNSA-N |
| XLogP | 3.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|